Molecular Definition

Canonical SMILES CS(=O)(=O)c1ccc(cc1)c2cc(cnc2N)c3ccc(O)cc3
Formula C18H16N2O3S
Molecular Weight 340.40 da
Stereocenters 0/0