Molecular Definition

Canonical SMILES NC(=O)c1ccc(cc1)c2cnc(N)c(c2)c3ccc(Cl)cc3
Formula C18H14ClN3O
Molecular Weight 323.78 da
Stereocenters 0/0