Molecular Definition

Canonical SMILES Oc1ccccc1C(=O)\C=C\N2C[C@H]3C[C@@H]2CN3c4ccccn4
Formula C19H19N3O2
Molecular Weight 321.37 da
Stereocenters 2/2