Molecular Definition

Canonical SMILES Cc1cc(cc(C)c1OC(C)(C)C(=O)O)n2nc3ccccc3n2
Formula C18H19N3O3
Molecular Weight 325.36 da
Stereocenters 0/0