Target Relevance

Molecular Definition

Canonical SMILES CCNc1nc2cc(Cl)c(cc2nc1NCC)C#CCCO
Formula C16H19ClN4O
Molecular Weight 318.80 da
Stereocenters 0/0