Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@@H]1CC[C@@H](CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F
Formula C23H30F3N5O
Molecular Weight 449.51 da
Stereocenters 2/2