Target Relevance

Molecular Definition

Canonical SMILES CC(=C)[C@@H]1CC[C@@H](CC1)N2CC(C2)NC(=O)CNc3ncnc4ccc(cc34)C(F)(F)F
Formula C23H28F3N5O
Molecular Weight 447.50 da
Stereocenters 2/2