Molecular Definition

Canonical SMILES Cc1c(F)c(ccc1c2ccccc2NS(=O)(=O)C)c3cnc(N)cn3
Formula C18H17FN4O2S
Molecular Weight 372.42 da
Stereocenters 0/0