Molecular Definition

Canonical SMILES Cc1cc(Oc2ccc(cc2C#N)S(=O)(=O)Nc3ccc(F)cn3)c(Cl)cc1Cl
Formula C19H12Cl2FN3O3S
Molecular Weight 452.29 da
Stereocenters 0/0