Target Relevance

Molecular Definition

Canonical SMILES CCOc1cc2CC(=O)N(C(c3ccc(Cl)cc3)c2cc1OCC)c4ccc(C)cc4OCCCN5CCOCC5
Formula C33H39ClN2O5
Molecular Weight 579.13 da
Stereocenters 0/1