Target Relevance

Molecular Definition

Canonical SMILES CC(C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(=O)O)\C=C\S(=O)(=O)C
Formula C28H38N4O13S
Molecular Weight 670.69 da
Stereocenters 4/4