Target Relevance

Molecular Definition

Canonical SMILES CC(C)CCCN1CC[C@@H](O)[C@H](O)[C@H]1CO
Formula C12H25NO3
Molecular Weight 231.33 da
Stereocenters 3/3