Molecular Definition

Canonical SMILES Fc1ccc(F)c(C(=O)NCc2ccc(cc2)C3=CC(=O)NC=C3)c1Cl
Formula C19H13ClF2N2O2
Molecular Weight 374.77 da
Stereocenters 0/0