Molecular Definition

Canonical SMILES COc1cc(cc(\C=N/CCO)c1O)c2cccs2
Formula C14H15NO3S
Molecular Weight 277.34 da
Stereocenters 0/0