Molecular Definition

Canonical SMILES COc1cc(cc(C=O)c1O)c2cccc(c2)C(=O)NCc3ccccc3
Formula C22H19NO4
Molecular Weight 361.39 da
Stereocenters 0/0