Molecular Definition

Canonical SMILES COc1cc(cc(C=O)c1O)c2cccc(c2)C(=O)NC3CCCCC3
Formula C21H23NO4
Molecular Weight 353.41 da
Stereocenters 0/0