Target Relevance

Molecular Definition

Canonical SMILES C[C@H]1Cn2c(nnc2c3cnccn3)C(=O)N1Cc4ccccc4
Formula C17H16N6O
Molecular Weight 320.35 da
Stereocenters 1/1