Molecular Definition

Canonical SMILES CS(=O)(=O)NCc1ccc(cc1)C2=COc3cc(ccc3C2=O)C#CC4(O)CCCC4
Formula C24H23NO5S
Molecular Weight 437.51 da
Stereocenters 0/0