Molecular Definition

Canonical SMILES COC(=O)c1cccc(CS(=O)(=O)N[C@H](CCCc2ccccc2)C(=O)N[C@@H](CCC3CCNCC3)C(=O)NCc4ccc(cc4)C(=N)N)c1
Formula C37H48N6O6S
Molecular Weight 704.88 da
Stereocenters 2/2