Molecular Definition

Canonical SMILES CC1(C)C(COc2cc(F)c(cc2Cl)C(=O)NS(=O)(=O)C)C1(C)C
Formula C16H21ClFNO4S
Molecular Weight 377.86 da
Stereocenters 0/0