Molecular Definition

Canonical SMILES CS(=O)(=O)NC(=O)c1ccc(CNC23CC4CC(CC(C4)C2)C3)c(Cl)c1
Formula C19H25ClN2O3S
Molecular Weight 396.93 da
Stereocenters 0/0