Molecular Definition

Canonical SMILES CC(C)(C)c1ccc(CCN2CCc3cc(ccc3C2)S(=O)(=O)Nc4ccc(OCCCc5ccccc5)cc4F)cn1
Formula C35H40FN3O3S
Molecular Weight 601.77 da
Stereocenters 0/0