Target Relevance

Molecular Definition

Canonical SMILES CN(C)CNC(=O)c1ccc(cc1NC2CCC(O)CC2)c3nccc4c(cccc34)c5cnc6ccccc6c5
Formula C34H35N5O2
Molecular Weight 545.67 da
Stereocenters 0/0