Target Relevance

Glucagon Tchem
pKi 70819 6.2

Molecular Definition

Canonical SMILES CC(C)C[C@@H](Nc1ccc(nc1)n2cc(cn2)C(F)(F)F)c3ccc(cn3)C(=O)NCCC(=O)O
Formula C23H25F3N6O3
Molecular Weight 490.48 da
Stereocenters 1/1