Target Relevance

Glucagon Tchem
pKi 70819 6.26

Molecular Definition

Canonical SMILES CCCC(Oc1ccc(cc1)c2cc(nn2C)C(F)(F)F)c3ccc(cc3)C(=O)NCCC(=O)O
Formula C25H26F3N3O4
Molecular Weight 489.49 da
Stereocenters 0/1