Molecular Definition

Canonical SMILES CCN(C1CCC1)C2CC[C@@H]([C@H](C2)C#N)n3cc(C(=O)N)c(Nc4ccc(Cl)cc4)n3
Formula C23H29ClN6O
Molecular Weight 440.97 da
Stereocenters 2/3