Molecular Definition

Canonical SMILES CN(c1ccccc1CNc2cccn3nc(Nc4ccc(cc4)N5CCN(C)CC5)nc23)S(=O)(=O)C
Formula C26H32N8O2S
Molecular Weight 520.65 da
Stereocenters 0/0