Target Relevance

Molecular Definition

Canonical SMILES CN1CCN(CC1)c2cccc(Nc3nc4c(Nc5ccccc5S(=O)(=O)C)cccn4n3)c2
Formula C24H27N7O2S
Molecular Weight 477.58 da
Stereocenters 0/0