Target Relevance

Molecular Definition

Canonical SMILES Ic1ccc2CN(C[C@@]3(NC(=O)NC3=O)C#Cc4cccnc4)C(=O)c2c1
Formula C19H13IN4O3
Molecular Weight 472.24 da
Stereocenters 1/1