Molecular Definition

Canonical SMILES C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)c2ccccc2
Formula C17H16Cl2N2O2
Molecular Weight 351.23 da
Stereocenters 1/1