Molecular Definition

Canonical SMILES Cn1cc(c2ccncc2)c(n1)c3ccc(OCc4cc(OCCOCCF)c5ccccc5n4)cc3
Formula C29H27FN4O3
Molecular Weight 498.55 da
Stereocenters 0/0