Target Relevance

Molecular Definition

Canonical SMILES COC1CCN(CC1)C(=O)c2ccc(Cn3nnc4C(=O)c5ccccc5C(=O)c34)cc2
Formula C24H22N4O4
Molecular Weight 430.46 da
Stereocenters 0/0