Molecular Definition

Canonical SMILES O=C(N1CCOCC1)c2cccc(Cn3nnc4C(=O)c5ccccc5C(=O)c34)c2
Formula C22H18N4O4
Molecular Weight 402.40 da
Stereocenters 0/0