Molecular Definition

Canonical SMILES Nc1ncc(C(=O)N[C@@H]2C[C@H](O)C2)c3ccc(nc13)c4cccc(F)c4
Formula C19H17FN4O2
Molecular Weight 352.36 da
Stereocenters 2/2