Molecular Definition

Canonical SMILES CCCC1=CC(=O)n2nc(NC(=O)c3ccc(Cl)cc3)c(C#N)c2N1
Formula C17H14ClN5O2
Molecular Weight 355.78 da
Stereocenters 0/0