Target Relevance

Molecular Definition

Canonical SMILES COC1=NN(Cc2cccc(N)c2)C(=O)O1
Formula C10H11N3O3
Molecular Weight 221.21 da
Stereocenters 0/0