Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(CNC2(CCCC2)c3nc(c[nH]3)c4ccc(C)cc4)cc1
Formula C23H27N3O
Molecular Weight 361.48 da
Stereocenters 0/0