Molecular Definition

Canonical SMILES Cc1cc(NCc2cccc(Cl)c2Cl)c3cccc(C(=O)N)c3n1
Formula C18H15Cl2N3O
Molecular Weight 360.24 da
Stereocenters 0/0