Molecular Definition

Canonical SMILES Cc1c(F)cccc1CCCCOc2ccc(cc2)C#Cc3ccc(F)c4c(CCCC(=O)O)c(C)n(CCCC(=O)O)c34
Formula C36H37F2NO5
Molecular Weight 601.68 da
Stereocenters 0/0