Molecular Definition

Canonical SMILES OC(=O)CCCc1cn(CC(=O)O)c2c(\C=C\c3ccc(OCCCCc4cccc(Cl)c4)cc3)cccc12
Formula C32H32ClNO5
Molecular Weight 546.05 da
Stereocenters 0/0