Molecular Definition

Canonical SMILES Cn1nncc1C(=O)Nc2ccc(c(N)n2)c3ccccc3OC(F)(F)F
Formula C16H13F3N6O2
Molecular Weight 378.31 da
Stereocenters 0/0