Molecular Definition

Canonical SMILES COc1ccc(Cl)c(SC2=C(O)CC(CC2=O)c3c(Cl)ccc(c3Cl)c4ccncc4)c1
Formula C24H18Cl3NO3S
Molecular Weight 506.83 da
Stereocenters 0/1