Molecular Definition

Canonical SMILES Cc1c(C(=O)C(=O)N)c2c(OCC(=O)O)cccc2n1Cc3ccccc3c4ccccc4
Formula C26H22N2O5
Molecular Weight 442.46 da
Stereocenters 0/0