Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc2c(\C=C\c3cccnc3)c[nH]c2c1
Formula C15H11FN2
Molecular Weight 238.26 da
Stereocenters 0/0