Target Relevance

Molecular Definition

Canonical SMILES C[C@@H](N)C(=O)N[C@@H](CCc1ccccc1)C(=O)NC(CCCCCCCCCN)C(=O)Nc2ccccc2
Formula C30H45N5O3
Molecular Weight 523.71 da
Stereocenters 2/3