Molecular Definition

Canonical SMILES N(c1ccncc1)c2ncnc3ccc(cc23)c4cncs4
Formula C16H11N5S
Molecular Weight 305.36 da
Stereocenters 0/0