Molecular Definition

Canonical SMILES Fc1cccc(Nc2ncnc3ccc(cc23)c4cncs4)c1
Formula C17H11FN4S
Molecular Weight 322.36 da
Stereocenters 0/0