Molecular Definition

Canonical SMILES Cc1cn(CCn2cnc(c3cnn(C)c3)c2c4ccc(cc4)C#N)nn1
Formula C19H18N8
Molecular Weight 358.40 da
Stereocenters 0/0