Target Relevance

Molecular Definition

Canonical SMILES CN(C)CCN1C(=O)Sc2cc(ccc12)S(=O)(=O)Nc3cccc4ccccc34
Formula C21H21N3O3S2
Molecular Weight 427.54 da
Stereocenters 0/0