Molecular Definition

Canonical SMILES CNc1ncc2ccc(Oc3c(C)ccc(C(=O)C4=C(N(C)N(C4=O)c5ccccc5)c6ccccc6)c3N)cc2n1
Formula C33H28N6O3
Molecular Weight 556.61 da
Stereocenters 0/0